Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCOC(=O)C1=C(N=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)C)C |
|---|---|
| IUPAC Name | ethyl 2,7-dimethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
| InChIKey | MQIKOXHYAYTALU-UHFFFAOYSA-N |
| INCHI | 1S/C17H15NO4/c1-4-21-17(20)11-8-13-15(19)12-7-9(2)5-6-14(12)22-16(13)18-10(11)3/h5-8H,4H2,1-3H3 |
| Isómeros SMILES | CCOC(=O)C1=C(N=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)C)C |
| PubChem CID | 1478332 |
| Peso molecular | 297.31 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Benzopyrans |
| Subclass | 1-benzopyrans |
| Intermediate Tree Nodes | Chromones |
| Direct Parent | Chromeno[2,3-b]pyridine-5-ones |
| Alternative Parents | Chromenopyridines Pyranopyridines Pyridinecarboxylic acids Pyranones and derivatives Methylpyridines Benzenoids Heteroaromatic compounds Carboxylic acid esters Azacyclic compounds Oxacyclic compounds Monocarboxylic acids and derivatives Organonitrogen compounds Organooxygen compounds Hydrocarbon derivatives Organic oxides Organopnictogen compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Chromeno[2,3-b]pyridine-5-one - Chromenopyridine - Pyranopyridine - Pyridine carboxylic acid - Pyridine carboxylic acid or derivatives - Pyranone - Methylpyridine - Pyran - Pyridine - Benzenoid - Heteroaromatic compound - Carboxylic acid ester - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Azacycle - Oxacycle - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as chromeno[2,3-b]pyridine-5-ones. These are compounds containing a Chromeno[2,3-b]pyridine moiety that carries an oxo group at the 5-position. |
| External Descriptors | Not available |
| Peso molecular | 297.300 g/mol |
|---|---|
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 297.1 Da |
| Monoisotopic Mass | 297.1 Da |
| Topological Polar Surface Area | 65.500 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 452.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |