Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504766132 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504766132 |
| Sonrisas canónicas | CCOC(=O)CO[Si](C)(C)C(C)(C)C |
| IUPAC Name | ethyl 2-[tert-butyl(dimethyl)silyl]oxyacetate |
| InChIKey | VMYQJDCENDEETH-UHFFFAOYSA-N |
| INCHI | 1S/C10H22O3Si/c1-7-12-9(11)8-13-14(5,6)10(2,3)4/h7-8H2,1-6H3 |
| Isómeros SMILES | CCOC(=O)CO[Si](C)(C)C(C)(C)C |
| Peso molecular | 218.37 |
| Reaxy-Rn | 2249392 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2249392&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Clase | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes |
| Direct Parent | Trialkylheterosilanes |
| Alternative Parents | Silyl ethers Carboxylic acid esters Organic metalloid salts Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkylheterosilane - Silyl ether - Carboxylic acid ester - Organic metalloid salt - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trialkylheterosilanes. These are organoheterosilanes, bearing a silicon atom linked to three alkyl groups and one heteroatom. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Jul 21, 2025 | E330998 | |
| Certificate of Analysis | Jul 21, 2025 | E330998 | |
| Certificate of Analysis | Jul 21, 2025 | E330998 | |
| Certificate of Analysis | Jul 09, 2025 | E330998 |
| Solubilidad | Soluble in Acetone, Chloroform, Dichloromethane, Ethyl Acetate and Methanol |
|---|---|
| Peso molecular | 218.360 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 6 |
| Exact Mass | 218.134 Da |
| Monoisotopic Mass | 218.134 Da |
| Topological Polar Surface Area | 35.500 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 194.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |