Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
Ethyl trimethylsilyl malonate is an ester.
| Sonrisas canónicas | CCOC(=O)CC(=O)O[Si](C)(C)C |
|---|---|
| IUPAC Name | 1-O-ethyl 3-O-trimethylsilyl propanedioate |
| InChIKey | PVXMKQLVICGFSI-UHFFFAOYSA-N |
| INCHI | 1S/C8H16O4Si/c1-5-11-7(9)6-8(10)12-13(2,3)4/h5-6H2,1-4H3 |
| Isómeros SMILES | CCOC(=O)CC(=O)O[Si](C)(C)C |
| WGK Alemania | 3 |
| Peso molecular | 204.30 |
| Reaxy-Rn | 3082383 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3082383&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Clase | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trimethylsilyl esters |
| Alternative Parents | Dicarboxylic acids and derivatives 1,3-dicarbonyl compounds Trialkylheterosilanes Carboxylic acid salts Carboxylic acid esters Organic metalloid salts Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trimethylsilyl ester - Dicarboxylic acid or derivatives - 1,3-dicarbonyl compound - Trialkylheterosilane - Carboxylic acid ester - Carboxylic acid salt - Carboxylic acid derivative - Organoheterosilane - Organic metalloid salt - Organooxygen compound - Organic oxide - Carbonyl group - Organic oxygen compound - Hydrocarbon derivative - Organic salt - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trimethylsilyl esters. These are organoheterosilanes, bearing a silicon atom that is linked to three methyl groups and is O-esterified. |
| External Descriptors | Not available |
| Sensibilidad | Moisture sensitive |
|---|---|
| Rotación específica [α] | 1.416 (lit.) |
| Punto de inflamación (°F) | 122 °F |
| Punto de inflamación (°C) | 50 °C |
| Punto de ebullición (°C) | 75 °C/0.5 mmHg (lit.) |
| Peso molecular | 204.300 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 6 |
| Exact Mass | 204.082 Da |
| Monoisotopic Mass | 204.082 Da |
| Topological Polar Surface Area | 52.600 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 195.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |