Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CS(=O)(=O)C1=CC=C(C=C1)C(C(CF)N)O |
|---|---|
| IUPAC Name | (1R,2S)-2-amino-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol |
| InChIKey | XLSYLQDVLAXIKK-NXEZZACHSA-N |
| INCHI | 1S/C10H14FNO3S/c1-16(14,15)8-4-2-7(3-5-8)10(13)9(12)6-11/h2-5,9-10,13H,6,12H2,1H3/t9-,10-/m1/s1 |
| Isómeros SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)N)O |
| CAS alternativo | 76639-93-5 |
| PubChem CID | 156406 |
| Términos de entrada MeSH | florfenicol amine;Sch 40458;Sch-40458 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzenesulfonyl compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzenesulfonyl compounds |
| Alternative Parents | Aralkylamines Sulfones Secondary alcohols 1,2-aminoalcohols Organopnictogen compounds Organofluorides Organic oxides Monoalkylamines Hydrocarbon derivatives Aromatic alcohols Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzenesulfonyl group - Aralkylamine - Sulfone - Sulfonyl - 1,2-aminoalcohol - Secondary alcohol - Organic nitrogen compound - Hydrocarbon derivative - Aromatic alcohol - Organic oxide - Organopnictogen compound - Organic oxygen compound - Primary amine - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Primary aliphatic amine - Amine - Alkyl halide - Alkyl fluoride - Alcohol - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzenesulfonyl compounds. These are aromatic compounds containing a benzenesulfonyl group, which consists of a monocyclic benzene moiety that carries a sulfonyl group. |
| External Descriptors | Not available |
| Peso molecular | 247.290 g/mol |
|---|---|
| XLogP3 | -0.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 247.068 Da |
| Monoisotopic Mass | 247.068 Da |
| Topological Polar Surface Area | 88.800 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 307.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Keyang Lai, Jun Xu, Kai Luo, Min Xie, Yuan Chen, Fan Li, Yaomin Zhou, Lihui Gong, Yonghua Xiong, Weihua Lai. (2024) Lateral flow immunoassay based on aggregation induced emission nanobeads for the sensitive and accurate detection of chloramphenicol in pig hair. ANALYTICAL BIOCHEMISTRY, [PMID:39608623] [10.1016/j.ab.2024.115728] |