Determine the necessary mass, volume, or concentration for preparing a solution.
≥97%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
A useful derivatization agent.
| Sonrisas canónicas | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)F |
|---|---|
| IUPAC Name | fluoro(triphenyl)silane |
| InChIKey | UBGXLEFOIVWVRP-UHFFFAOYSA-N |
| INCHI | 1S/C18H15FSi/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| Isómeros SMILES | C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(C3=CC=CC=C3)F |
| WGK Alemania | 3 |
| Peso molecular | 278.4 |
| Beilstein | 2941368 |
| Reaxy-Rn | 2941368 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2941368&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzene and substituted derivatives |
| Alternative Parents | Silyl monohalides Organoheterosilanes Organic metalloid salts Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Monocyclic benzene moiety - Silyl monohalide - Organoheterosilane - Organic metalloid salt - Hydrocarbon derivative - Organic salt - Organosilicon compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene. |
| External Descriptors | Not available |
| Sensibilidad | Air sensitive. |
|---|---|
| Punto de ebullición (°C) | 210°C |
| Punto de fusión (°C) | 62-64°C |
| Peso molecular | 278.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 278.093 Da |
| Monoisotopic Mass | 278.093 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 240.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Xiaogang Guo, Taotao Liang. (2019) Super-Efficient Synthesis of Mesh-like Superhydrophobic Nano-Aluminum/Iron (III) Oxide Energetic Films. Materials, 12 (2): (234). [PMID:30641952] [10.3390/ma12020234] |