Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Gibberellin A7 is a plant hormone that has been shown to promote the growth and elongation of cells. A plant hormone, Gibberellin A7 was first isolated from culture filtrates of the fungus Gibberella fujikuroi. Gibberellin A7 has 19 carbons, and is classified as a pentacyclic diterpenoid.
| Sonrisas canónicas | CC12C(C=CC3(C1C(C45C3CCC(C4)C(=C)C5)C(=O)O)OC2=O)O |
|---|---|
| IUPAC Name | (1R,2R,5R,8R,9S,10R,11S,12S)-12-hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| InChIKey | SEEGHKWOBVVBTQ-NFMPGMCNSA-N |
| INCHI | 1S/C19H22O5/c1-9-7-18-8-10(9)3-4-11(18)19-6-5-12(20)17(2,16(23)24-19)14(19)13(18)15(21)22/h5-6,10-14,20H,1,3-4,7-8H2,2H3,(H,21,22)/t10-,11-,12+,13-,14-,17-,18+,19-/m1/s1 |
| Isómeros SMILES | C[C@@]12[C@H](C=C[C@@]3([C@@H]1[C@@H]([C@]45[C@H]3CC[C@H](C4)C(=C)C5)C(=O)O)OC2=O)O |
| Peso molecular | 330.38 |
| Reaxy-Rn | 1329447 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1329447&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Clase | Prenol lipids |
| Subclass | Diterpenoids |
| Intermediate Tree Nodes | Gibberellins - C19-gibberellins |
| Direct Parent | C19-gibberellin 6-carboxylic acids |
| Alternative Parents | Diterpene lactones Gamma butyrolactones Dicarboxylic acids and derivatives Tetrahydrofurans Secondary alcohols Carboxylic acid esters Oxacyclic compounds Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | 20-norgibberellane-6-carboxylic acid - Diterpene lactone - Dicarboxylic acid or derivatives - Gamma butyrolactone - Tetrahydrofuran - Carboxylic acid ester - Lactone - Secondary alcohol - Carboxylic acid - Carboxylic acid derivative - Oxacycle - Organoheterocyclic compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Alcohol - Carbonyl group - Aliphatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as c19-gibberellin 6-carboxylic acids. These are c19-gibberellins with a carboxyl group at the 6-position. |
| External Descriptors | Gibberellins |
| Punto de fusión (°C) | 162 - 169°C |
|---|---|
| Peso molecular | 330.400 g/mol |
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 330.147 Da |
| Monoisotopic Mass | 330.147 Da |
| Topological Polar Surface Area | 83.800 Ų |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 725.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 8 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Lian-Ming ZHANG, Xiao-Ping WEI, Yan-Xi WEI, Jian-Ping LI, Ying ZENG. (2014) Determination of Trace Gibberellin A3 by Magnetic Self-assembly Molecularly Imprinted Electrochemical Sensor. CHINESE JOURNAL OF ANALYTICAL CHEMISTRY, [PMID:] [10.1016/S1872-2040(14)60780-5] |