Determine the necessary mass, volume, or concentration for preparing a solution.
≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Temperatura ambiente Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488193658 |
|---|---|
| Sonrisas canónicas | C1C(O1)COCC(C(C(C(F)F)(F)F)(F)F)(F)F |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoropentoxymethyl)oxirane |
| InChIKey | NABHRPSATHTFNS-UHFFFAOYSA-N |
| INCHI | 1S/C8H8F8O2/c9-5(10)7(13,14)8(15,16)6(11,12)3-17-1-4-2-18-4/h4-5H,1-3H2 |
| Isómeros SMILES | C1C(O1)COCC(C(C(C(F)F)(F)F)(F)F)(F)F |
| Peso molecular | 288.14 |
| Reaxy-Rn | 5338310 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=5338310&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Epoxides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Epoxides |
| Alternative Parents | Oxacyclic compounds Dialkyl ethers Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Oxacycle - Ether - Oxirane - Dialkyl ether - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as epoxides. These are compounds containing a cyclic ether with three ring atoms(one oxygen and two carbon atoms). |
| External Descriptors | Not available |
| Peso molecular | 288.130 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 7 |
| Exact Mass | 288.04 Da |
| Monoisotopic Mass | 288.04 Da |
| Topological Polar Surface Area | 21.800 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 293.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Chenya Zhuo, Huiming Kong, Ke Yi, Chun-Wei Chi, Jiabing Zhang, Ran Chen, Haixia Wang, Caixia Wu, Yeh-Hsing Lao, Yu Tao, Mingqiang Li. (2023) Magnetic-Activated Nanosystem with Liver-Specific CRISPR Nonviral Vector to Achieve Spatiotemporal Liver Genome Editing as Hepatitis B Therapeutics. ADVANCED FUNCTIONAL MATERIALS, 33 (7): (2210860). [PMID:] [10.1002/adfm.202210860] |
| 2. Xin Bai, Jian Nie, Siyao Cheng, Daohu Sheng, Jijun Xiao, Wei Dong. (2024) Biocompatible fluorinated poly(2-hydroxypropenimine)s for safe and efficient gene transfection. COLLOIDS AND SURFACES A-PHYSICOCHEMICAL AND ENGINEERING ASPECTS, [PMID:] [10.1016/j.colsurfa.2024.135575] |