Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C(=[NH2+])(N)N.C(=[NH2+])(N)N.[O-]S(=O)(=O)[O-] |
|---|---|
| IUPAC Name | diaminomethylideneazanium;sulfate |
| InChIKey | UYAKTBUPMOOXNW-UHFFFAOYSA-N |
| INCHI | 1S/2CH5N3.H2O4S/c2*2-1(3)4;1-5(2,3)4/h2*(H5,2,3,4);(H2,1,2,3,4) |
| Isómeros SMILES | C(=[NH2+])(N)N.C(=[NH2+])(N)N.[O-]S(=O)(=O)[O-] |
| CAS alternativo | 1184-68-5,113-00-8 (Parent) |
| PubChem CID | 129653717 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic sulfuric acids and derivatives |
| Subclass | Organic sulfuric acids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic sulfuric acids |
| Alternative Parents | Guanidines Carboximidamides Organopnictogen compounds Organic oxides Imines Hydrocarbon derivatives |
| Molecular Framework | Not available |
| Substituents | Sulfuric acid - Guanidine - Carboximidamide - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Imine - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as organic sulfuric acids. These are organic compounds containing the sulfuric acid functional group, with the generic structure HOS(=O)(=O)OH. |
| External Descriptors | Not available |
| Peso molecular | 216.220 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 216.064 Da |
| Monoisotopic Mass | 216.064 Da |
| Topological Polar Surface Area | 244.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 81.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |