Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C[N+](C)(C)CCCCCC[N+](C)(C)C.[Cl-].[Cl-] |
|---|---|
| IUPAC Name | trimethyl-[6-(trimethylazaniumyl)hexyl]azanium;dichloride |
| InChIKey | PYIHTIJNCRKDBV-UHFFFAOYSA-L |
| INCHI | 1S/C12H30N2.2ClH/c1-13(2,3)11-9-7-8-10-12-14(4,5)6;;/h7-12H2,1-6H3;2*1H/q+2;;/p-2 |
| Isómeros SMILES | C[N+](C)(C)CCCCCC[N+](C)(C)C.[Cl-].[Cl-] |
| WGK Alemania | 3 |
| RTECS | BQ8650000 |
| PubChem CID | 93550 |
| Peso molecular | 273.29 |
| Beilstein | 3714810 |
| Reaxy-Rn | 3714806 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Quaternary ammonium salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Hexamethonium compounds |
| Alternative Parents | Tetraalkylammonium salts Organopnictogen compounds Organic chloride salts Hydrocarbon derivatives Amines |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hexamethonium - Tetraalkylammonium salt - Organopnictogen compound - Hydrocarbon derivative - Organic chloride salt - Organic salt - Amine - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as hexamethonium compounds. These are organic compounds containing a N,N,N,N',N',N'-hexamethylhexane-1,6-diaminium moiety. |
| External Descriptors | Not available |
| Punto de fusión (°C) | 292°C(dec.)(lit.) |
|---|---|
| Peso molecular | 273.280 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 7 |
| Exact Mass | 272.179 Da |
| Monoisotopic Mass | 272.179 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 121.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |