HO-PEG14-OH is a PEG-based PROTAC linker that is applicable to the synthesis of PROTACs.
Application：
Applicated in medical research, drug-release, nanotechnology and new materials research, cell culture. In the study of ligand, polypeptide synthesis support, a graft polymer compounds, new materials, and polyethylene glycol-modified functional coatings and other aspects of the active compound.
| Pubchem Sid | 504759791 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504759791 |
| Sonrisas canónicas | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)O |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | ILLKMACMBHTSHP-UHFFFAOYSA-N |
| INCHI | 1S/C28H58O15/c29-1-3-31-5-7-33-9-11-35-13-15-37-17-19-39-21-23-41-25-27-43-28-26-42-24-22-40-20-18-38-16-14-36-12-10-34-8-6-32-4-2-30/h29-30H,1-28H2 |
| Isómeros SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)O |
| Peso molecular | 634.75 |
| Reaxy-Rn | 7501585 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=7501585&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Dialkyl ethers |
| Direct Parent | Polyethylene glycols |
| Alternative Parents | Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Polyethylene glycol - Hydrocarbon derivative - Primary alcohol - Alcohol - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as polyethylene glycols. These are oligomers or polymers of ethylene oxide, with the general formula (C2H4O)n (with n>=3). |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
 L2304207 | Certificate of Analysis | Nov 21, 2023 | H412758 |
| L2304208 | Certificate of Analysis | Nov 21, 2023 | H412758 |
| L2304209 | Certificate of Analysis | Nov 21, 2023 | H412758 |
| L2304212 | Certificate of Analysis | Nov 21, 2023 | H412758 |
| Solubilidad | Solubility (25°C) In vitro |
|---|---|
| Sensibilidad | Light sensitive |
| Peso molecular | 634.800 g/mol |
| XLogP3 | -3.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 15 |
| Rotatable Bond Count | 40 |
| Exact Mass | 634.378 Da |
| Monoisotopic Mass | 634.378 Da |
| Topological Polar Surface Area | 160.000 Ų |
| Heavy Atom Count | 43 |
| Formal Charge | 0 |
| Complexity | 439.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
