≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504757356 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504757356 |
| Sonrisas canónicas | C1=CC(=CC=C1CC(C(=O)N)N)O |
| IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)propanamide |
| InChIKey | PQFMNVGMJJMLAE-QMMMGPOBSA-N |
| INCHI | 1S/C9H12N2O2/c10-8(9(11)13)5-6-1-3-7(12)4-2-6/h1-4,8,12H,5,10H2,(H2,11,13)/t8-/m0/s1 |
| Isómeros SMILES | C1=CC(=CC=C1C[C@@H](C(=O)N)N)O |
| Peso molecular | 180.2 |
| Reaxy-Rn | 2805757 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2805757&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Tyrosine and derivatives |
| Alternative Parents | Phenylalanine and derivatives Alpha amino acid amides Amphetamines and derivatives Aralkylamines 1-hydroxy-2-unsubstituted benzenoids Fatty amides Primary carboxylic acid amides Organopnictogen compounds Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Tyrosine or derivatives - Phenylalanine or derivatives - Alpha-amino acid amide - Amphetamine or derivatives - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Aralkylamine - Monocyclic benzene moiety - Fatty amide - Fatty acyl - Benzenoid - Carboxamide group - Primary carboxylic acid amide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Organic oxide - Organic nitrogen compound - Carbonyl group - Organopnictogen compound - Organic oxygen compound - Primary amine - Amine - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as tyrosine and derivatives. These are compounds containing tyrosine or a derivative thereof resulting from reaction of tyrosine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| External Descriptors | amino acid amide - L-tyrosine derivative |
| Solubilidad | Soluble in 0.5 M HCl (50 mg/ml, clear faint yellow to yellow solution). |
|---|---|
| Peso molecular | 180.200 g/mol |
| XLogP3 | -0.600 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 180.09 Da |
| Monoisotopic Mass | 180.09 Da |
| Topological Polar Surface Area | 89.300 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 176.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Zhang Qiu-Long, Wang Liang-Liang, Liu Yan, Lin Jiao, Xu Liang. (2021) A kinetically controlled platform for ligand-oligonucleotide transduction. Nature Communications, 12 (1): (1-11). [PMID:34341342] [10.1038/s41467-021-24962-4] |
| 2. Meng Wang, Jun Xing, Yu-Tang Sun, Ling-Xiang Guo, Bao-Ping Lin, Hong Yang. (2018) Thiol–ene photoimmobilization of chymotrypsin on polysiloxane gels for enzymatic peptide synthesis. RSC Advances, 8 (22): (11843-11849). [PMID:35539381] [10.1039/C7RA13320K] |
D2224019