Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CC(N(C1)NC(=O)CCC(C(=O)O)N)C(=O)O |
|---|---|
| IUPAC Name | (2R)-1-[[(4S)-4-amino-4-carboxybutanoyl]amino]pyrrolidine-2-carboxylic acid |
| InChIKey | KWWHDNLMGLRNRN-NKWVEPMBSA-N |
| INCHI | 1S/C10H17N3O5/c11-6(9(15)16)3-4-8(14)12-13-5-1-2-7(13)10(17)18/h6-7H,1-5,11H2,(H,12,14)(H,15,16)(H,17,18)/t6-,7+/m0/s1 |
| Isómeros SMILES | C1C[C@@H](N(C1)NC(=O)CC[C@@H](C(=O)O)N)C(=O)O |
| CAS alternativo | 10139-06-7 |
| PubChem CID | 160920 |
| Términos de entrada MeSH | 1-((N-gamma-Glu)-amino)-Pro;1-((N-gamma-L-glutamyl)-amino)-D-proline;linatine |
| Peso molecular | 259.26 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Glutamine and derivatives |
| Alternative Parents | Proline and derivatives L-alpha-amino acids Pyrrolidine carboxylic acids Heterocyclic fatty acids Dicarboxylic acids and derivatives Carboxylic acid hydrazides Amino acids Carboxylic acids Azacyclic compounds Organopnictogen compounds Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Glutamine or derivatives - Proline or derivatives - Alpha-amino acid - L-alpha-amino acid - Pyrrolidine carboxylic acid - Pyrrolidine carboxylic acid or derivatives - Heterocyclic fatty acid - Dicarboxylic acid or derivatives - Fatty acid - Fatty acyl - Pyrrolidine - Carboxylic acid hydrazide - Amino acid - Azacycle - Organoheterocyclic compound - Carboxylic acid - Hydrocarbon derivative - Primary amine - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Organopnictogen compound - Organic oxygen compound - Organic oxide - Carbonyl group - Amine - Organic nitrogen compound - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as glutamine and derivatives. These are compounds containing glutamine or a derivative thereof resulting from reaction of glutamine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| External Descriptors | carbohydrazide - pyrrolidinemonocarboxylic acid - D-proline derivative |
| Peso molecular | 259.260 g/mol |
|---|---|
| XLogP3 | -5.100 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 6 |
| Exact Mass | 259.117 Da |
| Monoisotopic Mass | 259.117 Da |
| Topological Polar Surface Area | 133.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 346.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |