Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(HPLC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | 2 |
|---|
| Sonrisas canónicas | CC1=CC(=C(C=C1NC(=O)C)NS(=O)(=O)C(F)(F)F)C |
|---|---|
| IUPAC Name | N-[2,4-dimethyl-5-(trifluoromethylsulfonylamino)phenyl]acetamide |
| InChIKey | OKIBNKKYNPBDRS-UHFFFAOYSA-N |
| INCHI | 1S/C11H13F3N2O3S/c1-6-4-7(2)10(5-9(6)15-8(3)17)16-20(18,19)11(12,13)14/h4-5,16H,1-3H3,(H,15,17) |
| Isómeros SMILES | CC1=CC(=C(C=C1NC(=O)C)NS(=O)(=O)C(F)(F)F)C |
| PubChem CID | 40896 |
| Peso molecular | 310.29 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Sulfanilides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sulfanilides |
| Alternative Parents | Acetanilides N-acetylarylamines m-Xylenes Organosulfonamides Organic sulfonamides Aminosulfonyl compounds Acetamides Trihalomethanes Secondary carboxylic acid amides Organopnictogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Acetanilide - Sulfanilide - N-acetylarylamine - Anilide - N-arylamide - M-xylene - Xylene - Organic sulfonic acid amide - Organosulfonic acid amide - Organosulfonic acid or derivatives - Sulfonyl - Aminosulfonyl compound - Acetamide - Organic sulfonic acid or derivatives - Secondary carboxylic acid amide - Carboxamide group - Trihalomethane - Carboxylic acid derivative - Alkyl fluoride - Hydrocarbon derivative - Halomethane - Organic oxide - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Organopnictogen compound - Organic oxygen compound - Carbonyl group - Organic nitrogen compound - Alkyl halide - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as sulfanilides. These are organic aromatic compounds containing a sulfanilide moiety, with the general structure RS(=O)(=O)NC1=CC=CC=C1. |
| External Descriptors | Anilide herbicides |
| Peso molecular | 310.290 g/mol |
|---|---|
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 3 |
| Exact Mass | 310.06 Da |
| Monoisotopic Mass | 310.06 Da |
| Topological Polar Surface Area | 83.700 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 459.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |