Determine the necessary mass, volume, or concentration for preparing a solution.
Description
Menthide is a seven-membered, plant-derived lactone monomer that can be readily polymerized via ring opening polymerization (ROP). Controlled ROP has yielded aliphatic polyesters with high molecular weights and narrow molecular weight distributions (PDI). Menthide has been copolymerized with other biologically derived monomers, such as lactide, to yield products such as thermoplastic elastomers and pressure-sensitive adhesives.}
| Pubchem Sid | 504766030 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504766030 |
| Sonrisas canónicas | CC1CCC(OC(=O)C1)C(C)C |
| IUPAC Name | (4R,7S)-4-methyl-7-propan-2-yloxepan-2-one |
| InChIKey | GGAXPLCKKANQED-BDAKNGLRSA-N |
| INCHI | 1S/C10H18O2/c1-7(2)9-5-4-8(3)6-10(11)12-9/h7-9H,4-6H2,1-3H3/t8-,9+/m1/s1 |
| Isómeros SMILES | C[C@@H]1CC[C@H](OC(=O)C1)C(C)C |
| Peso molecular | 170.25 |
| Reaxy-Rn | 4840659 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4840659&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Lactones |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Lactones |
| Alternative Parents | Oxepanes Carboxylic acid esters Oxacyclic compounds Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Caprolactone - Oxepane - Lactone - Carboxylic acid ester - Oxacycle - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as lactones. These are cyclic esters of hydroxy carboxylic acids, containing a 1-oxacycloalkan-2-one structure, or analogues having unsaturation or heteroatoms replacing one or more carbon atoms of the ring. |
| External Descriptors | Menthane monoterpenoids |
| Sensibilidad | Sensitive humidity;Sensitive heat |
|---|---|
| Rotación específica [α] | -25.0 - -15.0 ° |
| Punto de inflamación (°F) | Not applicable |
| Punto de inflamación (°C) | Not applicable |
| Punto de fusión (°C) | 47 °C |
| Peso molecular | 170.250 g/mol |
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 170.131 Da |
| Monoisotopic Mass | 170.131 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 163.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |