Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC(=O)C1=C(C=CS1)N2C=CC=C2C(=O)C(Cl)(Cl)Cl |
|---|---|
| IUPAC Name | methyl 3-[2-(2,2,2-trichloroacetyl)pyrrol-1-yl]thiophene-2-carboxylate |
| InChIKey | DSWIGUGITFGKGJ-UHFFFAOYSA-N |
| INCHI | 1S/C12H8Cl3NO3S/c1-19-11(18)9-7(4-6-20-9)16-5-2-3-8(16)10(17)12(13,14)15/h2-6H,1H3 |
| Isómeros SMILES | COC(=O)C1=C(C=CS1)N2C=CC=C2C(=O)C(Cl)(Cl)Cl |
| PubChem CID | 3631084 |
| Peso molecular | 352.62 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Thiophenes |
| Subclass | Thiophene carboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thiophene carboxylic acids and derivatives |
| Alternative Parents | Aryl alkyl ketones Substituted pyrroles Vinylogous amides Methyl esters Heteroaromatic compounds Alpha-chloroketones Azacyclic compounds Organonitrogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Thiophene carboxylic acid or derivatives - Aryl ketone - Aryl alkyl ketone - Substituted pyrrole - Pyrrole - Alpha-haloketone - Alpha-chloroketone - Methyl ester - Vinylogous amide - Heteroaromatic compound - Carboxylic acid ester - Ketone - Carboxylic acid derivative - Azacycle - Organic nitrogen compound - Alkyl halide - Alkyl chloride - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as thiophene carboxylic acids and derivatives. These are compounds containing a thiophene ring which bears a carboxylic acid group (or a salt/ester thereof). |
| External Descriptors | Not available |
| Peso molecular | 352.600 g/mol |
|---|---|
| XLogP3 | 4.100 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 350.929 Da |
| Monoisotopic Mass | 350.929 Da |
| Topological Polar Surface Area | 76.500 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 402.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |