≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Methyl 3,5-dichloro-4-methoxybenzoate is a synthetic compound, and its unique chemical properties have been extensively studied in various research contexts, particularly in the fields of organic chemistry and materials science. Its molecular structure contains both electron-withdrawing chlorine groups and electron-donating methoxy groups, making it an interesting subject for studying reaction mechanisms, such as nucleophilic substitution reactions, and it has potential as a precursor in the synthesis of complex organic molecules. The dichloro and methoxy functional groups also confer a certain reactivity, allowing it to be used to modify polymer structures and thus influence the physical properties of advanced application materials. Therefore, methyl 3,5-dichloro-4-methoxybenzoate has become a valuable tool in the development of new synthetic routes and the creation of novel materials, driving the advancement of chemical science and materials engineering.
| Sonrisas canónicas | COC1=C(C=C(C=C1Cl)C(=O)OC)Cl |
|---|---|
| IUPAC Name | methyl 3,5-dichloro-4-methoxybenzoate |
| InChIKey | SHPKLAWJDWHSCJ-UHFFFAOYSA-N |
| INCHI | 1S/C9H8Cl2O3/c1-13-8-6(10)3-5(4-7(8)11)9(12)14-2/h3-4H,1-2H3 |
| Isómeros SMILES | COC1=C(C=C(C=C1Cl)C(=O)OC)Cl |
| Peso molecular | 235.07 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Punto de fusión (°C) | 74-77 °C |
|---|---|
| Peso molecular | 235.060 g/mol |
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 233.985 Da |
| Monoisotopic Mass | 233.985 Da |
| Topological Polar Surface Area | 35.500 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 198.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
A2621683