Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(=O)C1=C(C=C(S1)C(C)(C)C)NC(=O)CCC(=O)O |
|---|---|
| IUPAC Name | 4-[(2-acetyl-5-tert-butylthiophen-3-yl)amino]-4-oxobutanoic acid |
| InChIKey | XMCLFLQWXHXSGS-UHFFFAOYSA-N |
| INCHI | 1S/C14H19NO4S/c1-8(16)13-9(7-10(20-13)14(2,3)4)15-11(17)5-6-12(18)19/h7H,5-6H2,1-4H3,(H,15,17)(H,18,19) |
| Isómeros SMILES | CC(=O)C1=C(C=C(S1)C(C)(C)C)NC(=O)CCC(=O)O |
| PubChem CID | 2808306 |
| Peso molecular | 297.37 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | N-arylamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-arylamides |
| Alternative Parents | Aryl alkyl ketones 2,3,5-trisubstituted thiophenes Fatty amides Vinylogous amides Heteroaromatic compounds Secondary carboxylic acid amides Monocarboxylic acids and derivatives Carboxylic acids Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | N-arylamide - 2,3,5-trisubstituted thiophene - Aryl ketone - Aryl alkyl ketone - Fatty amide - Fatty acyl - Vinylogous amide - Heteroaromatic compound - Thiophene - Carboxamide group - Secondary carboxylic acid amide - Ketone - Organoheterocyclic compound - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Hydrocarbon derivative - Organooxygen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Carbonyl group - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as n-arylamides. These are organic compounds that contain a carboxamide group that is N-linked to a aryl group. They have the generic structure RC(=O)N(R')H, R = organyl group and R'= aryl group. |
| External Descriptors | Not available |
| Peso molecular | 297.370 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Exact Mass | 297.103 Da |
| Monoisotopic Mass | 297.103 Da |
| Topological Polar Surface Area | 112.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 402.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |