Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)CC(=O)C1=CNC(=C1)C(=O)NCC2=CC=CC=C2OC |
|---|---|
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-4-(3-methylbutanoyl)-1H-pyrrole-2-carboxamide |
| InChIKey | FXTCWSLOYUWYKI-UHFFFAOYSA-N |
| INCHI | 1S/C18H22N2O3/c1-12(2)8-16(21)14-9-15(19-11-14)18(22)20-10-13-6-4-5-7-17(13)23-3/h4-7,9,11-12,19H,8,10H2,1-3H3,(H,20,22) |
| Peso molecular | 314.400 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Pyrrole carboxamides Phenoxy compounds Methoxybenzenes Aryl alkyl ketones 2-heteroaryl carboxamides Alkyl aryl ethers Substituted pyrroles Vinylogous amides Heteroaromatic compounds Secondary carboxylic acid amides Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-heteroaryl carboxamide - Phenoxy compound - Anisole - Pyrrole-2-carboxamide - Pyrrole-2-carboxylic acid or derivatives - Methoxybenzene - Aryl ketone - Aryl alkyl ketone - Alkyl aryl ether - Monocyclic benzene moiety - Substituted pyrrole - Heteroaromatic compound - Pyrrole - Vinylogous amide - Secondary carboxylic acid amide - Ketone - Carboxamide group - Ether - Carboxylic acid derivative - Azacycle - Organoheterocyclic compound - Organic oxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic oxide - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
| Peso molecular | 314.400 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 7 |
| Exact Mass | 314.163 Da |
| Monoisotopic Mass | 314.163 Da |
| Topological Polar Surface Area | 71.200 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 411.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |