Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=CC(=C(N1NC(=O)C2=NNC(=O)C3=CC=CC=C32)C)C(=O)CCl |
|---|---|
| IUPAC Name | N-[3-(2-chloroacetyl)-2,5-dimethylpyrrol-1-yl]-4-oxo-3H-phthalazine-1-carboxamide |
| InChIKey | YIHQTDMLDQZILW-UHFFFAOYSA-N |
| INCHI | 1S/C17H15ClN4O3/c1-9-7-13(14(23)8-18)10(2)22(9)21-17(25)15-11-5-3-4-6-12(11)16(24)20-19-15/h3-7H,8H2,1-2H3,(H,20,24)(H,21,25) |
| Peso molecular | 358.800 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Diazanaphthalenes |
| Subclass | Benzodiazines |
| Intermediate Tree Nodes | Phthalazines |
| Direct Parent | Phthalazinones |
| Alternative Parents | Aryl alkyl ketones Pyridazinones Substituted pyrroles Benzenoids Vinylogous amides Alpha-chloroketones Heteroaromatic compounds Lactams Carboxylic acids and derivatives Azacyclic compounds Hydrocarbon derivatives Organic oxides Organochlorides Organonitrogen compounds Organopnictogen compounds Alkyl chlorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Phthalazinone - Aryl alkyl ketone - Aryl ketone - Pyridazinone - Pyridazine - Benzenoid - Substituted pyrrole - Alpha-haloketone - Alpha-chloroketone - Heteroaromatic compound - Vinylogous amide - Pyrrole - Ketone - Lactam - Carboxylic acid derivative - Azacycle - Alkyl chloride - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phthalazinones. These are compounds containing a phthalazine bearing a ketone group. |
| External Descriptors | Not available |
| Peso molecular | 358.800 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 358.083 Da |
| Monoisotopic Mass | 358.083 Da |
| Topological Polar Surface Area | 92.600 Ų |
| Heavy Atom Count | 25 |
| Formal Charge | 0 |
| Complexity | 609.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |