≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=CN=C(C(=C1OC)C)CNCC(C)C.Cl.Cl |
|---|---|
| IUPAC Name | N-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]-2-methylpropan-1-amine;dihydrochloride |
| InChIKey | GELJNVBMEYMYDE-UHFFFAOYSA-N |
| INCHI | 1S/C13H22N2O.2ClH/c1-9(2)6-14-8-12-11(4)13(16-5)10(3)7-15-12;;/h7,9,14H,6,8H2,1-5H3;2*1H |
| Isómeros SMILES | CC1=CN=C(C(=C1OC)C)CNCC(C)C.Cl.Cl |
| PubChem CID | 44120521 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyridines and derivatives |
| Subclass | 2-pyridylmethylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2-pyridylmethylamines |
| Alternative Parents | Methylpyridines Aralkylamines Alkyl aryl ethers Heteroaromatic compounds Dialkylamines Azacyclic compounds Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-pyridylmethylamine - Alkyl aryl ether - Aralkylamine - Methylpyridine - Heteroaromatic compound - Secondary aliphatic amine - Ether - Secondary amine - Azacycle - Organooxygen compound - Organonitrogen compound - Amine - Organic oxygen compound - Hydrochloride - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 2-pyridylmethylamines. These are aromatic heterocyclic compounds contaning a pyridine ring which is substituted at the 2-position with a methylamine. |
| External Descriptors | Not available |
| Peso molecular | 295.200 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 294.127 Da |
| Monoisotopic Mass | 294.127 Da |
| Topological Polar Surface Area | 34.200 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 196.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
![N-[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]-2-methylpropan-1-amine dihydrochloride - ≥97% , CAS No.1158429-31-2](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)