Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=NC(=CC(=N1)NCC2=CC=CC=C2OC)CSC3=CC=C(C=C3)Cl |
|---|---|
| IUPAC Name | 6-[(4-chlorophenyl)sulfanylmethyl]-N-[(2-methoxyphenyl)methyl]-2-methylpyrimidin-4-amine |
| InChIKey | BBGKPWLXJBFAPJ-UHFFFAOYSA-N |
| INCHI | 1S/C20H20ClN3OS/c1-14-23-17(13-26-18-9-7-16(21)8-10-18)11-20(24-14)22-12-15-5-3-4-6-19(15)25-2/h3-11H,12-13H2,1-2H3,(H,22,23,24) |
| Isómeros SMILES | CC1=NC(=CC(=N1)NCC2=CC=CC=C2OC)CSC3=CC=C(C=C3)Cl |
| PubChem CID | 1476645 |
| Peso molecular | 385.92 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Phenol ethers |
| Subclass | Anisoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anisoles |
| Alternative Parents | Thiophenol ethers Phenoxy compounds Methoxybenzenes Benzylamines Secondary alkylarylamines Alkyl aryl ethers Alkylarylthioethers Aminopyrimidines and derivatives Chlorobenzenes Imidolactams Aryl chlorides Heteroaromatic compounds Sulfenyl compounds Azacyclic compounds Hydrocarbon derivatives Organochlorides Organopnictogen compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenoxy compound - Aryl thioether - Anisole - Benzylamine - Methoxybenzene - Thiophenol ether - Alkyl aryl ether - Aminopyrimidine - Chlorobenzene - Halobenzene - Secondary aliphatic/aromatic amine - Alkylarylthioether - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Pyrimidine - Imidolactam - Heteroaromatic compound - Sulfenyl compound - Thioether - Secondary amine - Organoheterocyclic compound - Ether - Azacycle - Organopnictogen compound - Hydrocarbon derivative - Organic oxygen compound - Amine - Organic nitrogen compound - Organohalogen compound - Organochloride - Organonitrogen compound - Organooxygen compound - Organosulfur compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as anisoles. These are organic compounds containing a methoxybenzene or a derivative thereof. |
| External Descriptors | Not available |
| Peso molecular | 385.900 g/mol |
|---|---|
| XLogP3 | 5.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 7 |
| Exact Mass | 385.102 Da |
| Monoisotopic Mass | 385.102 Da |
| Topological Polar Surface Area | 72.300 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 409.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |