Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
N-Boc-PEG6-alcohol is a PEG derivative containing a Boc protected amine group and a terminal hydroxyl group. The Boc protecting group can be removed under acidic conditions. The hydroxyl group can be reacted to further derivatize the compound. The hydrophilic PEG linker increases the water solubility of the compound.
| Sonrisas canónicas | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCO |
|---|---|
| IUPAC Name | tert-butyl N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | JJZYGSPDXUBTNO-UHFFFAOYSA-N |
| INCHI | 1S/C17H35NO8/c1-17(2,3)26-16(20)18-4-6-21-8-10-23-12-14-25-15-13-24-11-9-22-7-5-19/h19H,4-15H2,1-3H3,(H,18,20) |
| Isómeros SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCO |
| Peso molecular | 381.46 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Ethers |
| Intermediate Tree Nodes | Dialkyl ethers |
| Direct Parent | Polyethylene glycols |
| Alternative Parents | Carbamate esters Primary alcohols Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Polyethylene glycol - Carbamic acid ester - Organic nitrogen compound - Organic oxide - Hydrocarbon derivative - Primary alcohol - Organonitrogen compound - Carbonyl group - Alcohol - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as polyethylene glycols. These are oligomers or polymers of ethylene oxide, with the general formula (C2H4O)n (with n>=3). |
| External Descriptors | Not available |
| Solubilidad | Solubility in DMSO, DCM, DMF |
|---|---|
| Peso molecular | 381.500 g/mol |
| XLogP3 | -0.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 19 |
| Exact Mass | 381.236 Da |
| Monoisotopic Mass | 381.236 Da |
| Topological Polar Surface Area | 105.000 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 322.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |