Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CN(C)C=NN=CN(C)C.Cl.Cl |
|---|---|
| IUPAC Name | N'-[(E)-dimethylaminomethylideneamino]-N,N-dimethylmethanimidamide;dihydrochloride |
| InChIKey | FFFCFXUJXOETMY-ZHINHYBUSA-N |
| INCHI | 1S/C6H14N4.2ClH/c1-9(2)5-7-8-6-10(3)4;;/h5-6H,1-4H3;2*1H/b7-5+,8-6+;; |
| Isómeros SMILES | CN(/C=N/N=C/N(C)C)C.Cl.Cl |
| PubChem CID | 23447537 |
| Peso molecular | 215.12 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Amidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Formamidines |
| Alternative Parents | Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Formamidine - Hydrocarbon derivative - Hydrochloride - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as formamidines. These are amidines with the general structure Amidines with the general structure RN=CHN(R')R\", where R, R',and R\" are any atoms not part of an amide or a thioamide group. |
| External Descriptors | Not available |
| Peso molecular | 215.120 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 214.075 Da |
| Monoisotopic Mass | 214.075 Da |
| Topological Polar Surface Area | 31.200 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 110.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 2 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 2 |
| Covalently-Bonded Unit Count | 3 |