Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Store at -20°C,Desiccated Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
(S)-2-(Methoxycarbonylamino)-3,3-dimethylbutanoic acid is a leucine derivative.
Application:
N-(Methoxycarbonyl)-L-tert-leucine is a naturally occurring carboxylic acid that can be found in various organisms. The mechanisms of action for N-(Methoxycarbonyl)-L-tert-leucine vary depending on the specific application. In enantioselective synthesis, it serves as a chiral modifier, influencing the stereoselectivity of a reaction. In organic synthesis, it functions as a reagent, catalyzing reactions. Lastly, in protein stabilization, it acts as a stabilizer, preserving the structural integrity of proteins.
| Sonrisas canónicas | CC(C)(C)C(C(=O)O)NC(=O)OC |
|---|---|
| IUPAC Name | (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoic acid |
| InChIKey | NWPRXAIYBULIEI-RXMQYKEDSA-N |
| INCHI | 1S/C8H15NO4/c1-8(2,3)5(6(10)11)9-7(12)13-4/h5H,1-4H3,(H,9,12)(H,10,11)/t5-/m1/s1 |
| Isómeros SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)OC |
| CAS alternativo | 162537-11-3 |
| PubChem CID | 11263950 |
| Peso molecular | 189.21 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Valine and derivatives |
| Alternative Parents | Methyl-branched fatty acids Methylcarbamates Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Valine or derivatives - Branched fatty acid - Methyl-branched fatty acid - Fatty acyl - Fatty acid - Methylcarbamate - Carbamic acid ester - Monocarboxylic acid or derivatives - Carboxylic acid - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as valine and derivatives. These are compounds containing valine or a derivative thereof resulting from reaction of valine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| External Descriptors | Not available |
| Punto de fusión (°C) | 107-110° C |
|---|---|
| Peso molecular | 189.210 g/mol |
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 189.1 Da |
| Monoisotopic Mass | 189.1 Da |
| Topological Polar Surface Area | 75.600 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 207.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |