≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CNC(=S)NNC(=O)C1=C(C=CS1)OCC2=CC(=CC=C2)C(F)(F)F |
|---|---|
| IUPAC Name | 1-methyl-3-[[3-[[3-(trifluoromethyl)phenyl]methoxy]thiophene-2-carbonyl]amino]thiourea |
| InChIKey | FGFQTLDILPRZDZ-UHFFFAOYSA-N |
| INCHI | 1S/C15H14F3N3O2S2/c1-19-14(24)21-20-13(22)12-11(5-6-25-12)23-8-9-3-2-4-10(7-9)15(16,17)18/h2-7H,8H2,1H3,(H,20,22)(H2,19,21,24) |
| Peso molecular | 389.400 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Trifluoromethylbenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trifluoromethylbenzenes |
| Alternative Parents | Thiophene carboxamides Alkyl aryl ethers Thiosemicarbazides Heteroaromatic compounds Carboxylic acid hydrazides Organosulfur compounds Organopnictogen compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Trifluoromethylbenzene - Thiophene carboxamide - Thiophene carboxylic acid or derivatives - Alkyl aryl ether - Thiophene - Heteroaromatic compound - Thiosemicarbazide - Carboxylic acid hydrazide - Carboxylic acid derivative - Ether - Organoheterocyclic compound - Organopnictogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Alkyl fluoride - Organic oxygen compound - Organic nitrogen compound - Organic oxide - Hydrocarbon derivative - Alkyl halide - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trifluoromethylbenzenes. These are organofluorine compounds that contain a benzene ring substituted with one or more trifluoromethyl groups. |
| External Descriptors | Not available |
| Peso molecular | 389.400 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 4 |
| Exact Mass | 389.048 Da |
| Monoisotopic Mass | 389.048 Da |
| Topological Polar Surface Area | 123.000 Ų |
| Heavy Atom Count | 25 |
| Formal Charge | 0 |
| Complexity | 479.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![N-methyl-2-[(3-{[3-(trifluoromethyl)benzyl]oxy}-2-thienyl)carbonyl]-1-hydrazinecarbothioamide - ≥90% , CAS No.343376-09-0](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)