Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=CC=C(C=C1)COC2=C(SC=C2)C(=O)NNC(=S)NC |
|---|---|
| IUPAC Name | 1-methyl-3-[[3-[(4-methylphenyl)methoxy]thiophene-2-carbonyl]amino]thiourea |
| InChIKey | ZISZGSDLAXWZND-UHFFFAOYSA-N |
| INCHI | 1S/C15H17N3O2S2/c1-10-3-5-11(6-4-10)9-20-12-7-8-22-13(12)14(19)17-18-15(21)16-2/h3-8H,9H2,1-2H3,(H,17,19)(H2,16,18,21) |
| Peso molecular | 335.400 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Thiophenes |
| Subclass | Thiophene carboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thiophene carboxamides |
| Alternative Parents | Toluenes Alkyl aryl ethers Thiosemicarbazides Heteroaromatic compounds Carboxylic acid hydrazides Organosulfur compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Thiophene carboxamide - Alkyl aryl ether - Toluene - Monocyclic benzene moiety - Benzenoid - Thiosemicarbazide - Heteroaromatic compound - Carboxylic acid hydrazide - Ether - Carboxylic acid derivative - Organic oxide - Organic nitrogen compound - Organopnictogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as thiophene carboxamides. These are compounds containing a thiophene ring which bears a carboxamide. |
| External Descriptors | Not available |
| Peso molecular | 335.400 g/mol |
|---|---|
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 335.076 Da |
| Monoisotopic Mass | 335.076 Da |
| Topological Polar Surface Area | 123.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 387.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |