Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C(C(=C1)C=NCCN=CC2=CC=CC=C2[O-])[O-].[Cl-].[Mn+3] |
|---|---|
| IUPAC Name | manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;chloride |
| InChIKey | HBQGFROGWOHBAG-UHFFFAOYSA-K |
| INCHI | 1S/C16H16N2O2.ClH.Mn/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;/h1-8,11-12,19-20H,9-10H2;1H;/q;;+3/p-3 |
| Isómeros SMILES | C1=CC=C(C(=C1)C=NCCN=CC2=CC=CC=C2[O-])[O-].[Cl-].[Mn+3] |
| WGK Alemania | 3 |
| PubChem CID | 171249 |
| Peso molecular | 356.69 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Phenoxides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenoxides |
| Alternative Parents | Shiff bases Propargyl-type 1,3-dipolar organic compounds Organic transition metal salts Organic metal halides Organooxygen compounds Organic zwitterions Organic oxides Organic chloride salts Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxide - Shiff base - Aldimine - Organic metal halide - Propargyl-type 1,3-dipolar organic compound - Organic transition metal salt - Organic 1,3-dipolar compound - Organic nitrogen compound - Organic salt - Organic chloride salt - Hydrocarbon derivative - Organic zwitterion - Organic oxide - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Imine - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenoxides. These are salts or analogous metal derivatives of phenols. |
| External Descriptors | Not available |
| Peso molecular | 356.680 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 5 |
| Exact Mass | 356.012 Da |
| Monoisotopic Mass | 356.012 Da |
| Topological Polar Surface Area | 70.800 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 298.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |