≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)(C)OC(N(C)C)OC(C)(C)C |
|---|---|
| IUPAC Name | N,N-dimethyl-1,1-bis[(2-methylpropan-2-yl)oxy]methanamine |
| InChIKey | DBNQIOANXZVWIP-UHFFFAOYSA-N |
| INCHI | 1S/C11H25NO2/c1-10(2,3)13-9(12(7)8)14-11(4,5)6/h9H,1-8H3 |
| Isómeros SMILES | CC(C)(C)OC(N(C)C)OC(C)(C)C |
| WGK Alemania | 3 |
| Peso molecular | 203.32 |
| Beilstein | 969629 |
| Reaxy-Rn | 969629 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=969629&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Orthocarboxylic acid derivatives |
| Subclass | Carboxylic acid amide acetals |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acid amide acetals |
| Alternative Parents | Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Amide acetal - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as carboxylic acid amide acetals. These are carboxylic acid derivatives two hydroxyl groups attached to a carbon atom, which in turn is linked to a nitrogen atom(substituted or not). |
| External Descriptors | Not available |
| Sensibilidad | Moisture Sensitive |
|---|---|
| Índice de refracción | 1.412 |
| Punto de inflamación (°F) | 33℃ |
| Punto de inflamación (°C) | 33℃ |
| Punto de ebullición (°C) | 57°C/8mmHg |
| Peso molecular | 203.320 g/mol |
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 203.189 Da |
| Monoisotopic Mass | 203.189 Da |
| Topological Polar Surface Area | 21.700 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 149.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
