Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Usually used in OLED multilayers and molecular magnets.
| Pubchem Sid | 488186228 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488186228 |
| Sonrisas canónicas | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC=C5 |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetraphenylbenzene-1,4-diamine |
| InChIKey | JPDUPGAVXNALOL-UHFFFAOYSA-N |
| INCHI | 1S/C30H24N2/c1-5-13-25(14-6-1)31(26-15-7-2-8-16-26)29-21-23-30(24-22-29)32(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-24H |
| Isómeros SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=CC=C5 |
| Peso molecular | 412.54 |
| Reaxy-Rn | 1893874 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1893874&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Triarylamines |
| Alternative Parents | Aniline and substituted anilines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Tertiary aromatic amine - Aniline or substituted anilines - Benzenoid - Monocyclic benzene moiety - Organopnictogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as triarylamines. These are organic compounds containing a trialkylamine group, characterized by exactly three aryl groups bonded to the amino nitrogen. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Sep 09, 2025 | N159580 | |
| Certificate of Analysis | Sep 09, 2025 | N159580 | |
| Certificate of Analysis | Apr 26, 2024 | N159580 | |
| Certificate of Analysis | Apr 26, 2024 | N159580 | |
| Certificate of Analysis | Dec 19, 2023 | N159580 |
| Punto de fusión (°C) | 203 °C |
|---|---|
| Peso molecular | 412.500 g/mol |
| XLogP3 | 9.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 6 |
| Exact Mass | 412.194 Da |
| Monoisotopic Mass | 412.194 Da |
| Topological Polar Surface Area | 6.500 Ų |
| Heavy Atom Count | 32 |
| Formal Charge | 0 |
| Complexity | 431.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Xiaobin Zhou, Xiaoling Li, Jianwen Wei, Yinming Fan, Lei Liao, Hongqiang Wang. (2020) Novel Nonaqueous Liquid–Liquid Biphasic Solvent for Energy-Efficient Carbon Dioxide Capture with Low Corrosivity. ENVIRONMENTAL SCIENCE & TECHNOLOGY, [PMID:33237769] [10.1021/acs.est.0c05774] |
| 2. Tian Lan, Wenjie Yang, Juan Peng, Mingke Li, Yinghan Wang. (2014) Effect of graft copolymer matrix prepared by reversible addition–fragmentation chain transfer and atom transfer radical polymerization on the electro-optical properties of polymer-dispersed liquid crystals. POLYMER INTERNATIONAL, 63 (9): (1691-1698). [PMID:] [10.1002/pi.4693] |