Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488186691 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488186691 |
| Sonrisas canónicas | C1CC(=O)OC(=O)C1N2C(=O)C3=CC=CC=C3C2=O |
| IUPAC Name | 2-(2,6-dioxooxan-3-yl)isoindole-1,3-dione |
| InChIKey | ICDLEMPZXFCQEB-UHFFFAOYSA-N |
| INCHI | 1S/C13H9NO5/c15-10-6-5-9(13(18)19-10)14-11(16)7-3-1-2-4-8(7)12(14)17/h1-4,9H,5-6H2 |
| Isómeros SMILES | C1CC(=O)OC(=O)C1N2C(=O)C3=CC=CC=C3C2=O |
| Peso molecular | 259.22 |
| Beilstein | 21(4)5370 |
| Reaxy-Rn | 90174 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=90174&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Isoindoles and derivatives |
| Subclass | Isoindolines |
| Intermediate Tree Nodes | Isoindolones |
| Direct Parent | Phthalimides |
| Alternative Parents | Alpha amino acids and derivatives Isoindoles Delta valerolactones Oxanes N-substituted carboxylic acid imides Dicarboxylic acids and derivatives Benzenoids Carboxylic acid anhydrides Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Phthalimide - Alpha-amino acid or derivatives - Isoindole - Delta valerolactone - Delta_valerolactone - Benzenoid - Oxane - Dicarboxylic acid or derivatives - Carboxylic acid imide, n-substituted - Carboxylic acid anhydride - Carboxylic acid imide - Lactone - Carboxylic acid derivative - Oxacycle - Azacycle - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Carbonyl group - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phthalimides. These are aromatic heterocyclic compounds containing a 1,3-dioxoisoindoline moiety. They are imide derivatives of phthalic anhydrides. |
| External Descriptors | Not available |
| Solubilidad | Soluble in Dioxane |
|---|---|
| Sensibilidad | Moisture Sensitive |
| Punto de fusión (°C) | 205 °C |
| Peso molecular | 259.209 g/mol |
| XLogP3 | 0.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 259.048 Da |
| Monoisotopic Mass | 259.048 Da |
| Topological Polar Surface Area | 80.800 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 448.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |