Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C(F)(F)(F)S(=NS(=O)(=O)C(F)(F)F)(=O)[O-] |
|---|---|
| IUPAC Name | 1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonimidate |
| InChIKey | AHXNYDBSLAVPLY-UHFFFAOYSA-M |
| INCHI | 1S/C2HF6NO4S2/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h(H,9,10,11)/p-1 |
| Isómeros SMILES | C(F)(F)(F)S(=NS(=O)(=O)C(F)(F)F)(=O)[O-] |
| PubChem CID | 4176748 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic sulfonic acids and derivatives |
| Subclass | Organosulfonic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organosulfonic acids and derivatives |
| Alternative Parents | Sulfonyls Sulfonimidic acids Trihalomethanes Organofluorides Organic oxides Organic nitrogen compounds Hydrocarbon derivatives Alkyl fluorides Organic anions |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Sulfonimidic acid - Sulfonyl - Organosulfonic acid or derivatives - Trihalomethane - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Halomethane - Hydrocarbon derivative - Organosulfur compound - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Organic anion - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as organosulfonic acids and derivatives. These are compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2X (R=alkyl, aryl; X=any heteroatom). |
| External Descriptors | Not available |
| Peso molecular | 280.150 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 11 |
| Rotatable Bond Count | 1 |
| Exact Mass | 279.917 Da |
| Monoisotopic Mass | 279.917 Da |
| Topological Polar Surface Area | 103.000 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | -1 |
| Complexity | 390.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |