Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC(=O)C(CO)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
|---|---|
| IUPAC Name | methyl (2S)-3-hydroxy-2-(tritylamino)propanoate |
| InChIKey | LXAWQKKSNNYYEK-NRFANRHFSA-N |
| INCHI | 1S/C23H23NO3/c1-27-22(26)21(17-25)24-23(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21,24-25H,17H2,1H3/t21-/m0/s1 |
| Isómeros SMILES | COC(=O)[C@H](CO)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| WGK Alemania | 3 |
| Peso molecular | 361.44 |
| Reaxy-Rn | 2821840 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2821840&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Triphenyl compounds |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Triphenyl compounds |
| Alternative Parents | Alpha amino acid esters Serine and derivatives Beta hydroxy acids and derivatives Aralkylamines Benzene and substituted derivatives Methyl esters Monocarboxylic acids and derivatives Dialkylamines Primary alcohols Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Triphenyl compound - Alpha-amino acid ester - Serine or derivatives - Alpha-amino acid or derivatives - Beta-hydroxy acid - Aralkylamine - Monocyclic benzene moiety - Hydroxy acid - Methyl ester - Amino acid or derivatives - Carboxylic acid ester - Secondary amine - Carboxylic acid derivative - Secondary aliphatic amine - Monocarboxylic acid or derivatives - Organooxygen compound - Hydrocarbon derivative - Carbonyl group - Organic oxide - Alcohol - Primary alcohol - Organic oxygen compound - Organic nitrogen compound - Amine - Organonitrogen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as triphenyl compounds. These are aromatic compounds containing a triphenyl moiety. |
| External Descriptors | Not available |
| Solubilidad | Soluble in Methanol |
|---|---|
| Rotación específica [α] | 33° (C=1,MeOH) |
| Punto de fusión (°C) | 148 °C |
| Peso molecular | 361.400 g/mol |
| XLogP3 | 3.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 8 |
| Exact Mass | 361.168 Da |
| Monoisotopic Mass | 361.168 Da |
| Topological Polar Surface Area | 58.600 Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 403.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |