Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 4 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)(C)CCNC(CC(=O)O)C(=O)NC(CC1=CC=CC=C1)C(=O)OC |
|---|---|
| IUPAC Name | (3S)-3-(3,3-dimethylbutylamino)-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | HLIAVLHNDJUHFG-HOTGVXAUSA-N |
| INCHI | 1S/C20H30N2O5/c1-20(2,3)10-11-21-15(13-17(23)24)18(25)22-16(19(26)27-4)12-14-8-6-5-7-9-14/h5-9,15-16,21H,10-13H2,1-4H3,(H,22,25)(H,23,24)/t15-,16-/m0/s1 |
| Isómeros SMILES | CC(C)(C)CCN[C@@H](CC(=O)O)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)OC |
| Peso molecular | 378.46 |
| Beilstein | 8352678 |
| Reaxy-Rn | 37813603 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=37813603&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Rotación específica [α] | -57° (C=1,MeOH) |
|---|---|
| Punto de fusión (°C) | 86 °C |
| Peso molecular | 378.500 g/mol |
| XLogP3 | -0.100 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 12 |
| Exact Mass | 378.215 Da |
| Monoisotopic Mass | 378.215 Da |
| Topological Polar Surface Area | 105.000 Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 495.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Ferry Saputra, Yu-Heng Lai, Rey Arturo T. Fernandez, Allan Patrick G. Macabeo, Hong-Thih Lai, Jong-Chin Huang, Chung-Der Hsiao. (2021) Acute and Sub-Chronic Exposure to Artificial Sweeteners at the Highest Environmentally Relevant Concentration Induce Less Cardiovascular Physiology Alterations in Zebrafish Larvae. Biology-Basel, 10 (6): (548). [PMID:34207293] [10.3390/biology10060548] |
| 2. Mengzhen Wang, Ling Ling, Shuyi Wang, Chuan-Fan Ding. (2024) A homogeneous binary matrix assisted laser desorption/ionization time-of-flight mass spectrometry assay for determination of artificial sweeteners in beverages. FOOD CHEMISTRY, [PMID:39079360] [10.1016/j.foodchem.2024.140597] |
| 3. Jing Xiao, Dali Zhuo, Jiayuan Tang, Jihong Chen, Chao Tan, Shu Zhang, Shichao Li, Zhirong Zou. (2024) Selective and sensitive detection of cyclamate in beverages using a portable pressure meter: A specific reaction-based analytical kit. MICROCHEMICAL JOURNAL, [PMID:] [10.1016/j.microc.2024.110959] |
| 4. Zhu Qingqing, Xie Fuwei, Zhao Ge, Yan Quanping, Hua Chenfeng, Shang Pingping, Chen Mantang, Chen Di, Ma Chengjie, Nie Cong. (2026) Development of a cell-based sweet perception model to study the metabolic effect of different sweeteners. Scientific Reports, [PMID:41748821] [10.1038/s41598-026-41678-x] |