Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
O-(2-Aminoethyl)-O′-(2-azidoethyl)heptaethylene glycol may be used for the chemical modification of biocompatible polymeric particles.
| Sonrisas canónicas | C(COCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])N |
|---|---|
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | ZSFGTBJYBWJOLZ-UHFFFAOYSA-N |
| INCHI | 1S/C18H38N4O8/c19-1-3-23-5-7-25-9-11-27-13-15-29-17-18-30-16-14-28-12-10-26-8-6-24-4-2-21-22-20/h1-19H2 |
| Isómeros SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-])N |
| WGK Alemania | 3 |
| Peso molecular | 438.52 |
| Reaxy-Rn | 27071975 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=27071975&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Clase | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Azo imides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azo imides |
| Alternative Parents | Azo compounds Dialkyl ethers Organic salts Monoalkylamines Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Azo imide - Azo compound - Ether - Dialkyl ether - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organic salt - Primary amine - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Amine - Organic cation - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as azo imides. These are n-Imides of azo compounds, analogous to azoxy compounds, having a delocalized structure. |
| External Descriptors | Not available |
| Sensibilidad | Air sensitive |
|---|---|
| Peso molecular | 438.500 g/mol |
| XLogP3 | -1.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 11 |
| Rotatable Bond Count | 26 |
| Exact Mass | 438.269 Da |
| Monoisotopic Mass | 438.269 Da |
| Topological Polar Surface Area | 114.000 Ų |
| Heavy Atom Count | 30 |
| Formal Charge | 0 |
| Complexity | 376.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |