| Pubchem Sid | 504758878 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758878 |
| Sonrisas canónicas | CC(=O)NC1C(C(C(OC1OC)CO)O)O |
| IUPAC Name | N-[(2S,3R,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]acetamide |
| InChIKey | ZEVOCXOZYFLVKN-ZEBDFXRSSA-N |
| INCHI | 1S/C9H17NO6/c1-4(12)10-6-8(14)7(13)5(3-11)16-9(6)15-2/h5-9,11,13-14H,3H2,1-2H3,(H,10,12)/t5-,6-,7+,8-,9+/m1/s1 |
| Isómeros SMILES | CC(=O)N[C@@H]1[C@H]([C@H]([C@H](O[C@@H]1OC)CO)O)O |
| Peso molecular | 235.23 |
| Reaxy-Rn | 39635949 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=39635949&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Aminosaccharides |
| Direct Parent | N-acyl-alpha-hexosamines |
| Alternative Parents | O-glycosyl compounds Oxanes Monosaccharides Acetamides Secondary carboxylic acid amides Secondary alcohols Oxacyclic compounds Acetals Primary alcohols Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | N-acyl-alpha-hexosamine - Glycosyl compound - O-glycosyl compound - Monosaccharide - Oxane - Acetamide - Secondary carboxylic acid amide - Secondary alcohol - Carboxamide group - Organoheterocyclic compound - Oxacycle - Carboxylic acid derivative - Acetal - Primary alcohol - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic nitrogen compound - Carbonyl group - Alcohol - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as n-acyl-alpha-hexosamines. These are carbohydrate derivatives containing a hexose moiety in which the oxygen atom is replaced by an n-acyl group. |
| External Descriptors | N-acetyl-alpha-D-galactosaminide |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
 F23271007 | Certificate of Analysis | Apr 02, 2026 | O333490 |
| F23271033 | Certificate of Analysis | Apr 02, 2026 | O333490 |
| F2327397 | Certificate of Analysis | Apr 02, 2026 | O333490 |
| F2327400 | Certificate of Analysis | Apr 02, 2026 | O333490 |
| F2327401 | Certificate of Analysis | Apr 02, 2026 | O333490 |
| F2327675 | Certificate of Analysis | Apr 02, 2026 | O333490 |
| I2509112 | Certificate of Analysis | May 08, 2023 | O333490 |
| Solubilidad | Soluble in Methanol |
|---|---|
| Sensibilidad | Moisture sensitive |
| Punto de fusión (°C) | 217-219°C (lit.) |
| Peso molecular | 235.230 g/mol |
| XLogP3 | -2.100 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 3 |
| Exact Mass | 235.106 Da |
| Monoisotopic Mass | 235.106 Da |
| Topological Polar Surface Area | 108.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 248.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 5 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
