Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488185727 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488185727 |
| Sonrisas canónicas | C1=CC=C(C(=C1)OCC(=O)O)OCC(=O)O |
| IUPAC Name | 2-[2-(carboxymethoxy)phenoxy]acetic acid |
| InChIKey | PPZYHOQWRAUWAY-UHFFFAOYSA-N |
| INCHI | 1S/C10H10O6/c11-9(12)5-15-7-3-1-2-4-8(7)16-6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14) |
| Isómeros SMILES | C1=CC=C(C(=C1)OCC(=O)O)OCC(=O)O |
| WGK Alemania | 3 |
| Peso molecular | 226.18 |
| Beilstein | 2057228 |
| Reaxy-Rn | 2057228 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2057228&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Peso molecular | 226.180 g/mol |
|---|---|
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Exact Mass | 226.048 Da |
| Monoisotopic Mass | 226.048 Da |
| Topological Polar Surface Area | 93.100 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 226.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Dongqi Yue, Yuejie Chen, Yuxin Wu, Hou Chen, Liangjiu Bai, Wenxiang Wang, Huawei Yang, Lixia Yang, Donglei Wei. (2023) Fabrication of anti-freezing and self-healing nanocomposite hydrogels based on zwitterionic proline and cellulose nanocrystals. Sustainable Materials and Technologies, [PMID:] [10.1016/j.susmat.2023.e00653] |
| 2. Tiezhu Guo, Xiaodan Lin, Xingsong Hu, Shaowei Cui, Xiaolian Chen. (2018) Direct synthesis of zirconium containing phenyl silicone resin for LED encapsulation. INTERNATIONAL JOURNAL OF POLYMER ANALYSIS AND CHARACTERIZATION, [PMID:] [10.1080/1023666X.2017.1403240] |