for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Cool Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=CC=CC=C1N=NC2=C(C=CC3=CC=CC=C32)O |
|---|---|
| IUPAC Name | 1-[(2-methylphenyl)diazenyl]naphthalen-2-ol |
| InChIKey | BQFCCCIRTOLPEF-UHFFFAOYSA-N |
| INCHI | 1S/C17H14N2O/c1-12-6-2-5-9-15(12)18-19-17-14-8-4-3-7-13(14)10-11-16(17)20/h2-11,20H,1H3 |
| Isómeros SMILES | CC1=CC=CC=C1N=NC2=C(C=CC3=CC=CC=C32)O |
| RTECS | QL5425000 |
| Peso molecular | 262.31 |
| Reaxy-Rn | 959684 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=959684&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Naphthalenes |
| Subclass | Naphthols and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthols and derivatives |
| Alternative Parents | Toluenes 1-hydroxy-2-unsubstituted benzenoids Azo compounds Propargyl-type 1,3-dipolar organic compounds Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | 2-naphthol - 1-hydroxy-2-unsubstituted benzenoid - Toluene - Phenol - Monocyclic benzene moiety - Azo compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as naphthols and derivatives. These are naphthalene derivatives carrying one or more hydroxyl (-OH) groups at any ring position. |
| External Descriptors | Not available |
| Solubilidad | Insoluble in water; Slightly soluble in Benzene,Acetone,Chloroform,Ethanol |
|---|---|
| Punto de fusión (°C) | 128 °C |
| Peso molecular | 262.300 g/mol |
| XLogP3 | 5.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 262.111 Da |
| Monoisotopic Mass | 262.111 Da |
| Topological Polar Surface Area | 45.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 344.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Peizhang Zhou, Yuanyang Yan, Jiang Cheng, Cailong Zhou. (2023) Directional Self-Transportation of Droplets on Superwetting Wedge-Shaped Surface in Air and Underliquid Environments. ACS Applied Materials & Interfaces, [PMID:36740783] [10.1021/acsami.2c21392] |
J2513799