Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Store at -20°C,Desiccated Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
PEG22 is a polymeric structure consisting of ethylene glycol units and two terminal hydroxyl groups. The hydroxyl group can be reacted to further derivatize the compound. The hydrophilic PEG linkers increase the water solubility of the compound in aqueous media. The water solubility properties of the PEG linker are enhanced with longer PEG chains.
| Isómeros SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)O |
|---|---|
| Peso molecular | 943.12 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →| Peso molecular | 943.100 g/mol |
|---|---|
| XLogP3 | -4.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 22 |
| Rotatable Bond Count | 61 |
| Exact Mass | 942.561 Da |
| Monoisotopic Mass | 942.561 Da |
| Topological Polar Surface Area | 225.000 Ų |
| Heavy Atom Count | 64 |
| Formal Charge | 0 |
| Complexity | 736.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Zhengli Peng, Mo Zhu, Jinxian Yang, Lianwei Li. (2022) How does Poly(ethylene glycol) with varied chain length affect the thermo-responsive behavior of methyl cellulose in aqueous solutions?. POLYMER, [PMID:] [10.1016/j.polymer.2022.125510] |