Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488196298 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488196298 |
| Sonrisas canónicas | C1=CC=C(C=C1)S(=O)C(F)(F)F |
| IUPAC Name | trifluoromethylsulfinylbenzene |
| InChIKey | WZAJOJWOOXXUCT-UHFFFAOYSA-N |
| INCHI | 1S/C7H5F3OS/c8-7(9,10)12(11)6-4-2-1-3-5-6/h1-5H |
| Isómeros SMILES | C1=CC=C(C=C1)S(=O)C(F)(F)F |
| PubChem CID | 9794162 |
| Peso molecular | 194.17 |
| Reaxy-Rn | 2443059 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Phenyl sulfoxides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenyl sulfoxides |
| Alternative Parents | Trihalomethanes Sulfoxides Sulfinyl compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenyl sulfoxide - Trihalomethane - Sulfoxide - Sulfinyl compound - Organic oxygen compound - Organic oxide - Halomethane - Hydrocarbon derivative - Organosulfur compound - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenyl sulfoxides. These are organosulfur compounds containing a sulfoxide group substituted with a phenyl group. |
| External Descriptors | Not available |
| Sensibilidad | air sensitive |
|---|---|
| Índice de refracción | 1.49 |
| Punto de inflamación (°C) | 83 °C |
| Punto de ebullición (°C) | 82°C/10mmHg |
| Peso molecular | 194.180 g/mol |
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 194.001 Da |
| Monoisotopic Mass | 194.001 Da |
| Topological Polar Surface Area | 36.300 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 172.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |