Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488190034 |
|---|---|
| Sonrisas canónicas | C[Si](C)(C)OC(=O)CC1=CC=CC=C1 |
| IUPAC Name | trimethylsilyl 2-phenylacetate |
| InChIKey | WWCXSUHALKENOU-UHFFFAOYSA-N |
| INCHI | 1S/C11H16O2Si/c1-14(2,3)13-11(12)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| Isómeros SMILES | C[Si](C)(C)OC(=O)CC1=CC=CC=C1 |
| WGK Alemania | 3 |
| PubChem CID | 519815 |
| Peso molecular | 208.33 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Clase | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trimethylsilyl esters |
| Alternative Parents | Benzene and substituted derivatives Trialkylheterosilanes Carboxylic acid salts Organic metalloid salts Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Trimethylsilyl ester - Monocyclic benzene moiety - Benzenoid - Trialkylheterosilane - Carboxylic acid salt - Carboxylic acid derivative - Organoheterosilane - Monocarboxylic acid or derivatives - Organic metalloid salt - Organooxygen compound - Carbonyl group - Organic oxygen compound - Organic oxide - Organic salt - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trimethylsilyl esters. These are organoheterosilanes, bearing a silicon atom that is linked to three methyl groups and is O-esterified. |
| External Descriptors | Not available |
| Sensibilidad | Moisture sensitive |
|---|---|
| Punto de inflamación (°F) | 170.6 °F |
| Punto de inflamación (°C) | 77 °C |
| Peso molecular | 208.330 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 208.092 Da |
| Monoisotopic Mass | 208.092 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 190.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |