Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)COP(=S)(OCC(C)C)[S-].[Na+] |
|---|---|
| IUPAC Name | sodium;bis(2-methylpropoxy)-sulfanylidene-sulfido-\u03bb5-phosphane |
| InChIKey | FOYPFIDVYRCZKA-UHFFFAOYSA-M |
| INCHI | 1S/C8H19O2PS2.Na/c1-7(2)5-9-11(12,13)10-6-8(3)4;/h7-8H,5-6H2,1-4H3,(H,12,13);/q;+1/p-1 |
| Isómeros SMILES | CC(C)COP(=S)(OCC(C)C)[S-].[Na+] |
| CAS alternativo | 53378-51-1 |
| PubChem CID | 23688597 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic dithiophosphoric acids and derivatives |
| Subclass | Dithiophosphate O-esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phosphorodithioic acid O,O-diesters |
| Alternative Parents | Thiophosphoric acid esters Organooxygen compounds Organic sodium salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Phosphorodithioic acid o,o-diester - Organic thiophosphoric acid or derivatives - Thiophosphoric acid ester - Organic alkali metal salt - Organic oxygen compound - Hydrocarbon derivative - Organic sodium salt - Organic salt - Organooxygen compound - Organic cation - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phosphorodithioic acid o,o-diesters. These are organooxygen compounds that contain a phosphorodithioic acid, which is O,O-disubstituted by an organyl group. |
| External Descriptors | Not available |
| Peso molecular | 264.300 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 6 |
| Exact Mass | 264.038 Da |
| Monoisotopic Mass | 264.038 Da |
| Topological Polar Surface Area | 51.600 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 172.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |