Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)(C)[Si](C)(C)OCC(=O)[O-].[K+] |
|---|---|
| IUPAC Name | potassium;2-[tert-butyl(dimethyl)silyl]oxyacetate |
| InChIKey | JDGHJVUBSIMFEL-UHFFFAOYSA-M |
| INCHI | 1S/C8H18O3Si.K/c1-8(2,3)12(4,5)11-6-7(9)10;/h6H2,1-5H3,(H,9,10);/q;+1/p-1 |
| Isómeros SMILES | CC(C)(C)[Si](C)(C)OCC(=O)[O-].[K+] |
| PubChem CID | 112756452 |
| Peso molecular | 228.4 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Clase | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes |
| Direct Parent | Trialkylheterosilanes |
| Alternative Parents | Silyl ethers Carboxylic acid salts Organic metalloid salts Monocarboxylic acids and derivatives Carboxylic acids Organic zwitterions Organic potassium salts Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkylheterosilane - Carboxylic acid salt - Silyl ether - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Organic metalloid salt - Organic alkali metal salt - Organic zwitterion - Organic oxide - Organooxygen compound - Organic salt - Organic potassium salt - Organic oxygen compound - Carbonyl group - Hydrocarbon derivative - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trialkylheterosilanes. These are organoheterosilanes, bearing a silicon atom linked to three alkyl groups and one heteroatom. |
| External Descriptors | Not available |
| Peso molecular | 228.400 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 228.058 Da |
| Monoisotopic Mass | 228.058 Da |
| Topological Polar Surface Area | 49.400 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 175.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |