Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | [B-](C1=CC(=CC=C1)CC#N)(F)(F)F.[K+] |
|---|---|
| IUPAC Name | potassium;[3-(cyanomethyl)phenyl]-trifluoroboranuide |
| InChIKey | ZKCMUCHAKQYUMT-UHFFFAOYSA-N |
| INCHI | 1S/C8H6BF3N.K/c10-9(11,12)8-3-1-2-7(6-8)4-5-13;/h1-3,6H,4H2;/q-1;+1 |
| Isómeros SMILES | [B-](C1=CC(=CC=C1)CC#N)(F)(F)F.[K+] |
| PubChem CID | 53397200 |
| Peso molecular | 223 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzyl cyanides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzyl cyanides |
| Alternative Parents | Boronic acid derivatives Organic metalloid salts Organic metal halides Nitriles Organopnictogen compounds Organometalloid compounds Organic potassium salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzyl-cyanide - Boronic acid derivative - Carbonitrile - Organic metal halide - Nitrile - Organic alkali metal salt - Organic metalloid salt - Organic nitrogen compound - Organopnictogen compound - Organic potassium salt - Organic salt - Organonitrogen compound - Organic metalloid moeity - Hydrocarbon derivative - Cyanide - Organic cation - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzyl cyanides. These are organic compounds containing an acetonitrile with one hydrogen replaced by a phenyl group. |
| External Descriptors | Not available |
| Peso molecular | 223.050 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 223.018 Da |
| Monoisotopic Mass | 223.018 Da |
| Topological Polar Surface Area | 23.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 222.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |