Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | [B-](C(C(F)(F)F)(F)F)(F)(F)F.[K+] |
|---|---|
| IUPAC Name | potassium;trifluoro(1,1,2,2,2-pentafluoroethyl)boranuide |
| InChIKey | PSJPJAFBTMLFFX-UHFFFAOYSA-N |
| INCHI | 1S/C2BF8.K/c4-1(5,2(6,7)8)3(9,10)11;/q-1;+1 |
| Isómeros SMILES | [B-](C(C(F)(F)F)(F)F)(F)(F)F.[K+] |
| WGK Alemania | 3 |
| PubChem CID | 56776485 |
| Peso molecular | 225.92 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Boronic acid derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Boronic acid derivatives |
| Alternative Parents | Alkylhaloboranes Organic metalloid salts Organic metal halides Organofluorides Organic potassium salts Monoalkylboranes Hydrocarbon derivatives Alkyl fluorides Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Boronic acid derivative - Alkylhaloborane - Organic metalloid salt - Organic metal halide - Organic alkali metal salt - Alkyl fluoride - Alkyl halide - Hydrocarbon derivative - Alkylborane - Organic potassium salt - Organic salt - Organofluoride - Organic metalloid moeity - Organohalogen compound - Monoalkylborane - Organic cation - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as boronic acid derivatives. These are compounds comprising any derivative of the boronic acid functional group, with the general structure RB(X)Y (R=alkyl, aryl; X,Y= any O, N, Hal residue). |
| External Descriptors | Not available |
| Peso molecular | 225.920 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 0 |
| Exact Mass | 225.96 Da |
| Monoisotopic Mass | 225.96 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 144.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |