Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C(C(F)(F)F)(C(F)(F)Cl)(F)Cl |
|---|---|
| IUPAC Name | 1,2-dichloro-1,1,2,3,3,3-hexafluoropropane |
| InChIKey | JSEUKVSKOHVLOV-UHFFFAOYSA-N |
| INCHI | 1S/C3Cl2F6/c4-1(6,2(5,7)8)3(9,10)11 |
| Isómeros SMILES | C(C(F)(F)F)(C(F)(F)Cl)(F)Cl |
| CAS alternativo | 42560-98-5,661-97-2 |
| PubChem CID | 61193 |
| Número NSC | 76603 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Clase | Alkyl halides |
| Subclass | Alkyl chlorides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Chlorofluorocarbons |
| Alternative Parents | Organofluorides Organochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Chlorofluorocarbon - Hydrocarbon derivative - Organofluoride - Organochloride - Alkyl fluoride - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as chlorofluorocarbons. These are alkyhalide compounds that are composed only of chlorine, fluorine, and carbon atoms. |
| External Descriptors | Not available |
| Peso molecular | 220.930 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 219.928 Da |
| Monoisotopic Mass | 219.928 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 152.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |