Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=C(N(C(=C1)C=O)CCCCC(C(=O)O)N)CO |
|---|---|
| IUPAC Name | (2S)-2-amino-6-[2-formyl-5-(hydroxymethyl)pyrrol-1-yl]hexanoic acid |
| InChIKey | VTYFITADLSVOAS-NSHDSACASA-N |
| INCHI | 1S/C12H18N2O4/c13-11(12(17)18)3-1-2-6-14-9(7-15)4-5-10(14)8-16/h4-5,7,11,16H,1-3,6,8,13H2,(H,17,18)/t11-/m0/s1 |
| Isómeros SMILES | C1=C(N(C(=C1)C=O)CCCC[C@@H](C(=O)O)N)CO |
| CAS alternativo | 74509-14-1 |
| PubChem CID | 122228 |
| Términos de entrada MeSH | 2-amino-6-(2-formyl-5-hydroxymethylpyrrol-1-yl)hexanoic acid;2-FHMPN;2-formyl-5-(hydroxymethyl)pyrrole-1-norleucine;pyrraline |
| Peso molecular | 254.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives - Alpha amino acids |
| Direct Parent | L-alpha-amino acids |
| Alternative Parents | Medium-chain fatty acids Amino fatty acids Aryl-aldehydes Heterocyclic fatty acids Hydroxy fatty acids Substituted pyrroles Heteroaromatic compounds Amino acids Azacyclic compounds Carboxylic acids Monocarboxylic acids and derivatives Organopnictogen compounds Primary alcohols Organic oxides Aromatic alcohols Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | L-alpha-amino acid - Medium-chain fatty acid - Amino fatty acid - Heterocyclic fatty acid - Hydroxy fatty acid - Aryl-aldehyde - Substituted pyrrole - Fatty acid - Fatty acyl - Heteroaromatic compound - Pyrrole - Amino acid - Azacycle - Organoheterocyclic compound - Carboxylic acid - Monocarboxylic acid or derivatives - Hydrocarbon derivative - Alcohol - Primary amine - Primary alcohol - Organooxygen compound - Organonitrogen compound - Aromatic alcohol - Primary aliphatic amine - Organopnictogen compound - Organic oxygen compound - Organic oxide - Carbonyl group - Organic nitrogen compound - Aldehyde - Amine - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as l-alpha-amino acids. These are alpha amino acids which have the L-configuration of the alpha-carbon atom. |
| External Descriptors | non-proteinogenic L-alpha-amino acid - L-lysine derivative - pyrroles |
| Peso molecular | 254.280 g/mol |
|---|---|
| XLogP3 | -3.000 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 8 |
| Exact Mass | 254.127 Da |
| Monoisotopic Mass | 254.127 Da |
| Topological Polar Surface Area | 106.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 285.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |