Determine the necessary mass, volume, or concentration for preparing a solution.
≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
Highly selective organocatalyst for 1,3-dipolar addition and Friedel-Crafts alkylation.
| Sonrisas canónicas | CC(C)(C)C1NCC(=O)N1C.C(=O)(C(F)(F)F)O |
|---|---|
| IUPAC Name | (2R)-2-tert-butyl-3-methylimidazolidin-4-one;2,2,2-trifluoroacetic acid |
| InChIKey | HKHKOEMMPVPVOS-OGFXRTJISA-N |
| INCHI | 1S/C8H16N2O.C2HF3O2/c1-8(2,3)7-9-5-6(11)10(7)4;3-2(4,5)1(6)7/h7,9H,5H2,1-4H3;(H,6,7)/t7-;/m1./s1 |
| Isómeros SMILES | CC(C)(C)[C@@H]1NCC(=O)N1C.C(=O)(C(F)(F)F)O |
| WGK Alemania | 2 |
| Peso molecular | 270.25 |
| Reaxy-Rn | 14751517 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14751517&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Alpha amino acids and derivatives |
| Alternative Parents | Imidazolidinones Tertiary carboxylic acid amides Alpha-halocarboxylic acids Lactams Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Amines Alkyl fluorides |
| Molecular Framework | Not available |
| Substituents | Alpha-amino acid or derivatives - Imidazolidinone - Alpha-halocarboxylic acid - Alpha-halocarboxylic acid or derivatives - Imidazolidine - Tertiary carboxylic acid amide - Carboxamide group - Lactam - Organoheterocyclic compound - Carboxylic acid - Azacycle - Monocarboxylic acid or derivatives - Organonitrogen compound - Alkyl fluoride - Organohalogen compound - Hydrocarbon derivative - Organofluoride - Carbonyl group - Amine - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Organooxygen compound - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alpha amino acids and derivatives. These are amino acids in which the amino group is attached to the carbon atom immediately adjacent to the carboxylate group (alpha carbon), or a derivative thereof. |
| External Descriptors | Not available |
| Peso molecular | 270.250 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 270.119 Da |
| Monoisotopic Mass | 270.119 Da |
| Topological Polar Surface Area | 69.600 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 255.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |