≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)(C)[Si](C)(C)OC(CC(=O)O)CC(=O)OC |
|---|---|
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-5-oxopentanoic acid |
| InChIKey | CTZDWHZODOCMCT-SECBINFHSA-N |
| INCHI | 1S/C12H24O5Si/c1-12(2,3)18(5,6)17-9(7-10(13)14)8-11(15)16-4/h9H,7-8H2,1-6H3,(H,13,14)/t9-/m1/s1 |
| Isómeros SMILES | CC(C)(C)[Si](C)(C)O[C@H](CC(=O)O)CC(=O)OC |
| PubChem CID | 10062024 |
| Peso molecular | 276.41 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Clase | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid methyl esters |
| Alternative Parents | Dicarboxylic acids and derivatives Trialkylheterosilanes Methyl esters Silyl ethers Organic metalloid salts Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid methyl ester - Dicarboxylic acid or derivatives - Trialkylheterosilane - Methyl ester - Carboxylic acid ester - Silyl ether - Carboxylic acid derivative - Carboxylic acid - Organoheterosilane - Organic metalloid salt - Organooxygen compound - Organic metalloid moeity - Carbonyl group - Organosilicon compound - Organic oxide - Hydrocarbon derivative - Organic oxygen compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as fatty acid methyl esters. These are compounds containing a fatty acid that is esterified with a methyl group. They have the general structure RC(=O)OR', where R=fatty aliphatic tail or organyl group and R'=methyl group. |
| External Descriptors | Not available |
| Peso molecular | 276.400 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 8 |
| Exact Mass | 276.139 Da |
| Monoisotopic Mass | 276.139 Da |
| Topological Polar Surface Area | 72.800 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 306.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
