Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504771823 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504771823 |
| Sonrisas canónicas | CC(C(=O)O)N=[N+]=[N-].C1CCC(CC1)N |
| IUPAC Name | (2S)-2-azidopropanoic acid;cyclohexanamine |
| InChIKey | CGKQKHCXMKZFEF-WNQIDUERSA-N |
| INCHI | 1S/C6H13N.C3H5N3O2/c7-6-4-2-1-3-5-6;1-2(3(7)8)5-6-4/h6H,1-5,7H2;2H,1H3,(H,7,8)/t;2-/m.0/s1 |
| Isómeros SMILES | C[C@@H](C(=O)O)N=[N+]=[N-].C1CCC(CC1)N |
| PubChem CID | 66519952 |
| Peso molecular | 214.26 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alanine and derivatives |
| Alternative Parents | Cyclohexylamines Azo imides Azo compounds Monocarboxylic acids and derivatives Carboxylic acids Organic salts Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds Organic cations |
| Molecular Framework | Not available |
| Substituents | Alanine or derivatives - Cyclohexylamine - Azo compound - Azo imide - Carboxylic acid - Monocarboxylic acid or derivatives - Amine - Organic nitrogen compound - Primary amine - Organooxygen compound - Organonitrogen compound - Organic salt - Primary aliphatic amine - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic oxygen compound - Organic cation - Aliphatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alanine and derivatives. These are compounds containing alanine or a derivative thereof resulting from reaction of alanine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| External Descriptors | Not available |
| Sensibilidad | Moisture sensitive;light sensitive |
|---|---|
| Peso molecular | 214.270 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 214.143 Da |
| Monoisotopic Mass | 214.143 Da |
| Topological Polar Surface Area | 77.700 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 184.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |