Determine the necessary mass, volume, or concentration for preparing a solution.
0.05M in toluene for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C[Si](C)(C)OC(C1CCCN1)(C2=CC=CC=C2)C3=CC=CC=C3 |
|---|---|
| IUPAC Name | [diphenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane |
| InChIKey | RSUHWMSTWSSNOW-IBGZPJMESA-N |
| INCHI | 1S/C20H27NOSi/c1-23(2,3)22-20(19-15-10-16-21-19,17-11-6-4-7-12-17)18-13-8-5-9-14-18/h4-9,11-14,19,21H,10,15-16H2,1-3H3/t19-/m0/s1 |
| Isómeros SMILES | C[Si](C)(C)OC([C@@H]1CCCN1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| WGK Alemania | 3 |
| Peso molecular | 325.52 |
| Reaxy-Rn | 18829165 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=18829165&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Diphenylmethanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylmethanes |
| Alternative Parents | Aralkylamines Trialkylheterosilanes Pyrrolidines Silyl ethers Organic metalloid salts Dialkylamines Azacyclic compounds Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Diphenylmethane - Aralkylamine - Trialkylheterosilane - Pyrrolidine - Silyl ether - Secondary aliphatic amine - Organoheterosilane - Azacycle - Organic metalloid salt - Organoheterocyclic compound - Secondary amine - Amine - Organosilicon compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic metalloid moeity - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as diphenylmethanes. These are compounds containing a diphenylmethane moiety, which consists of a methane wherein two hydrogen atoms are replaced by two phenyl groups. |
| External Descriptors | Not available |
| Índice de refracción | 1.5513 |
|---|---|
| Rotación específica [α] | -50° (C=1,CHCl3) |
| Punto de inflamación (°F) | >230 °F |
| Punto de inflamación (°C) | >110 °C |
| Peso molecular | 325.500 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 5 |
| Exact Mass | 325.186 Da |
| Monoisotopic Mass | 325.186 Da |
| Topological Polar Surface Area | 21.300 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 348.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Hongfeng Chen, Yan Li, Jue Cheng, Yanlong Luo, Qingsong Lian. (2023) Directly Using Paraffin as the Toughening Agent of Epoxy Composites: An Experimental and Molecular Dynamics Simulation Study. LANGMUIR, [PMID:36622385] [10.1021/acs.langmuir.2c02439] |
| 2. Dan Feng, Yan Xia. (2018) Covalent organic framework as efficient desorption/ionization matrix for direct detection of small molecules by laser desorption/ionization mass spectrometry. ANALYTICA CHIMICA ACTA, [PMID:29523252] [10.1016/j.aca.2018.02.017] |